| Primary information |
|---|
| ID | 20717 |
| Pubchem ID | NA |
| Name | Leukotriene B4 |
| Description | Leukotriene B4 is the major metabolite in neutrophil polymorphonuclear leukocytes. Leukotrienes are metabolites of arachidonic acid derived from the action of 5-LO (5-lipoxygenase). The immediate product of 5-LO is LTA4 (leukotriene A4); which is enzymatically converted into either LTB4 (leukotriene |
| Synonym | (5S;12R;6Z;8E;10E;14Z)-5;12-Dihydroxy-6;8;10;14-eicosatetraenoic acidChEBI(5S;6Z;8E;10E;12R;14Z)-5;12-Dihydroxyeicosa-6;8;10;14-tetraenoic acidChEBI(S-(R*;s*-(e;Z;e;Z)))-5;12-dihydroxy-6;8;10;14-eicos |
| Molecular Weight | 336.4657 |
| Formula | NA |
| IUPAC | (5S;6Z;8E;10E;12R;14Z)-5;12-dihydroxyicosa-6;8;10;14-tetraenoic acid |
| SMILE | CCCCCC=C/C[C@@H](O)C=CC=CC=C/[C@@H](O)CCCC(O)=O |
| PDB ID | NA |
| KEGG | C02165 |
| HMDB ID | HMDB0001085 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | DB12961 |
| Receptor | Q9NPC1; Q15722; Q9JJL9; O88855; Q9R0Q2; Q3T181; Q924U0 |
| Reference | HMDB
|