| Primary information |
|---|
| ID | 20716 |
| Pubchem ID | NA |
| Name | Arachidonic acid |
| Description | Arachidonic acid is a polyunsaturated; essential fatty acid that has a 20-carbon chain as a backbone and four cis-double bonds at the C5; C8; C11; and C14 positions. It is found in animal and human fat as well as in the liver; brain; and glandular organs; and is a constituent of animal phosphatides. |
| Synonym | (5Z;8Z;11Z;14Z)-5;8;11;14-Icosatetraenoic acidChEBI(5Z;8Z;11Z;14Z)-Icosatetraenoic acidChEBIAAChEBIall-cis-5;8;11;14-Eicosatetraenoic acidChEBIARAChEBIArachidonateChEBIArachidonsaeureChEBIcis-5;8;11;1 |
| Molecular Weight | 304.4669 |
| Formula | NA |
| IUPAC | (5Z;8Z;11Z;14Z)-icosa-5;8;11;14-tetraenoic acid |
| SMILE | CCCCCC=C/CC=C/CC=C/CC=C/CCCC(O)=O |
| PDB ID | NA |
| KEGG | C00219 |
| HMDB ID | HMDB0001043 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | DB04557 |
| Receptor | NA |
| Reference | HMDB
|