| Primary information |
|---|
| ID | 20715 |
| Pubchem ID | NA |
| Name | Anandamide |
| Description | Anandamide; also known as arachidonoylethanolamide (AEA); is a highly potent endogenous agonist of the cannabinoid CB1 and CB2 receptors. CB1 receptors are predominantly found in the central nervous system (CNS) where they mainly mediate the psychotropic effects of tetrahydrocannabinol (THC) and end |
| Synonym | (5Z;8Z;11Z;14Z)-N-(2-Hydroxyethyl)-5;8;11;14-eicosatetraenamideChEBI(all-Z)-N-(2-Hydroxyethyl)-5;8;11;14-eicosatetraenamideChEBIAEAChEBIAnandamide (20.4; N-6)ChEBIAnandamide(20:4; N-6)ChEBIArachidonic |
| Molecular Weight | 347.5347 |
| Formula | NA |
| IUPAC | (5Z;8Z;11Z;14Z)-N-(2-hydroxyethyl)icosa-5;8;11;14-tetraenamide |
| SMILE | CCCCCC=C/CC=C/CC=C/CC=C/CCCC(=O)NCCO |
| PDB ID | NA |
| KEGG | C11695 |
| HMDB ID | HMDB0004080 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|