| Primary information |
|---|
| ID | 20714 |
| Pubchem ID | NA |
| Name | 6-trans-Leukotriene B4 |
| Description | 6-trans-Leukotriene B4 is an enzymatic metabolite of leukotriene B4(LTB4). A greater increase in LTB4 and 6-trans-LTB4 (one of its hydroxylated 5-lipoxygenase metabolic derivatives) occurs after stimulation with calcium-ionophore in asthma patients compared to healthy controls. LTB4 is the major met |
| Synonym | (5S;6E;8E;10E;12R;14Z)-5;12-Dihydroxyeicosa-6;8;10;14-tetraenoic acidChEBI(6E;5S;12R)-Leukotriene b4ChEBI5(S);12(R)-Dihydroxy-6;8;10;14-(trans;trans;trans;cis)-eicosatetraenoic acidChEBI5S;12R-Dihydro |
| Molecular Weight | 336.4657 |
| Formula | NA |
| IUPAC | (5S;6E;8E;10E;12R;14Z)-5;12-dihydroxyicosa-6;8;10;14-tetraenoic acid |
| SMILE | CCCCCC=C/C[C@@H](O)C=CC=CC=C[C@@H](O)CCCC(O)=O |
| PDB ID | NA |
| KEGG | NA |
| HMDB ID | HMDB0005087 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|