| Primary information |
|---|
| ID | 20710 |
| Pubchem ID | NA |
| Name | 20-Hydroxy-leukotriene B4 |
| Description | 20-hydroxy- Leukotriene B4 (20-OH-LTB4) is an omega-hydroxylated metabolite of leukotriene B4 in human neutrophils. Elevated urinary concentrations of 20-OH-LTB4 and LTB4 are found in patients with Sjogren-Larsson syndrome |
| Synonym | (6Z;8E;10E;14Z)-(5S;12R)-5;12;20-Trihydroxyeicosa-6;8;10;14-tetraenoateChEBI(6Z;8E;10E;14Z)-(5S;12R)-5;12;20-Trihydroxyicosa-6;8;10;14-tetraenoateChEBI20-Hydroxy-LTB4ChEBI20-OH-Leukotriene b4ChEBI20-O |
| Molecular Weight | 352.4651 |
| Formula | NA |
| IUPAC | (5S;6Z;8E;10E;12R;14Z)-5;12;20-trihydroxyicosa-6;8;10;14-tetraenoic acid |
| SMILE | OCCCCCC=C/C[C@@H](O)C=CC=CC=C/[C@@H](O)CCCC(O)=O |
| PDB ID | NA |
| KEGG | C04853 |
| HMDB ID | HMDB0001509 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|