| Primary information |
|---|
| ID | 20705 |
| Pubchem ID | NA |
| Name | 15-Deoxy-d-12;14-PGJ2 |
| Description | 15-deoxy-PGJ2 (15d-PGJ2) is a metabolite of the PGJ2 prostanoid family that influences multiple signaling pathways by covalently binding with key signaling molecules. Among them; 15d-PGJ2 has displayed highest potency as an inducer of gene expression. Prostanoids are a subclass of the lipid mediator |
| Synonym | 15-Deoxy-delta-12;14-PGJ2ChEBI15-Deoxy-delta-12;14-prostaglandin J2ChEBI15-Deoxy-PGJ2ChEBIdelta-12;14-15-Deoxy-PGJ2ChEBI15-Deoxy-Delta12;14-prostaglandin J2Kegg15-Deoxy-δ-12;14-PGJ2Generator15-Deoxy-δ |
| Molecular Weight | 316.4345 |
| Formula | C20H28O3 |
| IUPAC | (5Z)-7-[(1S;5E)-5-[(2E)-oct-2-en-1-ylidene]-4-oxocyclopent-2-en-1-yl]hept-5-enoic acid |
| SMILE | CCCCCC=CC=C1/[C@@H](CC=C/CCCC(O)=O)C=CC1=O |
| PDB ID | NA |
| KEGG | C14717 |
| HMDB ID | HMDB0005079 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|