| Primary information |
|---|
| ID | 20704 |
| Pubchem ID | NA |
| Name | 12-Keto-leukotriene B4 |
| Description | 12-Keto-leukotriene B4 is formed when leukotriene B4 (LTB4) is metabolized by beta-oxidation. LTB4 is the major metabolite in neutrophil polymorphonuclear leukocytes. Leukotrienes are metabolites of arachidonic acid derived from the action of 5-LO (5-lipoxygenase). The immediate product of 5-LO is L |
| Synonym | (5S;6Z;8E;10E;14Z)-5-Hydroxy-12-oxoeicosa-6;8;10;14-tetraenoic acidChEBI12-Keto-LTB4ChEBI12-oxo-LTB4ChEBI12-Oxoleukotriene b4ChEBI5(S)-Hydroxy-12-oxo-6(Z);8(e);10(e);14(Z)-eicosatetraenoic acidChEBI5- |
| Molecular Weight | 334.4498 |
| Formula | C20H30O4 |
| IUPAC | (5S;6Z;8E;10E;14Z)-5-hydroxy-12-oxoicosa-6;8;10;14-tetraenoic acid |
| SMILE | CCCCCC=C/CC(=O)C=CC=CC=C/[C@@H](O)CCCC(O)=O |
| PDB ID | NA |
| KEGG | C05949 |
| HMDB ID | HMDB0004234 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|