| Primary information |
|---|
| ID | 20702 |
| Pubchem ID | NA |
| Name | 12-Keto-tetrahydro-leukotriene B4 |
| Description | 12-keto-tetrahydro-Leukotriene B4 is an inactivated enzymatic metabolite of leukotriene B4(LTB4); product of the human liver enzyme leukotriene B4 (LTB4) 12-hydroxydehydrogenase; also found in the porcine kidney and other mammals. LTB4 is the major metabolite in neutrophil polymorphonuclear leukocyt |
| Synonym | 12-Keto-10;11;14;15-tetrahydro-LTB4; 5S-Hydroxy-12-keto-6Z;8E-eicosadienoate; 5S-Hydroxy-12-keto-6Z;8E-eicosadienoic acid |
| Molecular Weight | 338.4816 |
| Formula | C20H34O4 |
| IUPAC | (5S;6Z;8E)-5-hydroxy-12-oxoicosa-6;8-dienoic acid |
| SMILE | CCCCCCCCC(=O)CCC=CC=C/[C@@H](O)CCCC(O)=O |
| PDB ID | NA |
| KEGG | C02165 |
| HMDB ID | HMDB0002995 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|