| Primary information |
|---|
| ID | 20699 |
| Pubchem ID | NA |
| Name | Testosterone |
| Description | Testosterone is the primary male sex hormone and anabolic steroid from the androstane class of steroids. It is the most important androgen in potency and quantity for vertebrates. In humans; testosterone plays a key role in the development of male reproductive tissues such as testes and prostate; as |
| Synonym | 17beta-Hydroxy-4-androsten-3-oneChEBI4-Androsten-17beta-ol-3-oneChEBIAndrodermChEBITestosteronChEBITestosteronaChEBITestosteronumChEBIAndrogelKeggAxironKeggStriantKeggTestimKegg17b-Hydroxy-4-androsten |
| Molecular Weight | 288.4244 |
| Formula | C19H28O2 |
| IUPAC | (1S;2R;10R;11S;14S;15S)-14-hydroxy-2;15-dimethyltetracyclo[8.7.0.0^{2;7}.0^{11;15}]heptadec-6-en-5-one |
| SMILE | [H][C@@]12CC[C@H](O)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CCC2=CC(=O)CC[C@]12C |
| PDB ID | NA |
| KEGG | C00535 |
| HMDB ID | HMDB0000234 |
| Melting Point (Degree C) | 155 |
| Water Solubility | 0.023 mg/mL |
| Drugbank ID | DB00624 |
| Receptor | NA |
| Reference | HMDB
|