| Primary information |
|---|
| ID | 20698 |
| Pubchem ID | NA |
| Name | Progesterone |
| Description | The major progestational steroid that is secreted primarily by the corpus luteum and the placenta. |
| Synonym | (S)-4-Pregnene-3;20-dioneChEBI(S)-Pregn-4-en-3;20-dioneChEBI(S)-ProgesteroneChEBI17alpha-ProgesteroneChEBI4-Pregnene-3;20-dioneChEBIAgolutinChEBIAkrolutinChEBICorpus luteum hormoneChEBICrinoneChEBIDel |
| Molecular Weight | 314.4617 |
| Formula | C21H30O2 |
| IUPAC | (1S;2R;10S;11S;14S;15S)-14-acetyl-2;15-dimethyltetracyclo[8.7.0.0^{2;7}.0^{11;15}]heptadec-6-en-5-one |
| SMILE | [H][C@@]12CC[C@H](C(C)=O)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CCC2=CC(=O)CC[C@]12C |
| PDB ID | NA |
| KEGG | C00410 |
| HMDB ID | HMDB0001830 |
| Melting Point (Degree C) | 121 |
| Water Solubility | 0.0088 mg/mL at 25 °C |
| Drugbank ID | DB00396 |
| Receptor | NA |
| Reference | HMDB
|