Primary information |
---|
ID | 20696 |
Pubchem ID | NA |
Name | Estrone |
Description | Estrone is a major mammalian estrogen. The conversion of the natural C19 steroids; testosterone and androstenedione into estrone is dependent on a complex key reaction catalyzed by the cytochrome P450 aromatase |
Synonym | 3-Hydroxy-1;3;5(10)-estratrien-17-oneChEBIFollicular hormoneChEBIFolliculinChEBIOestroneChEBI(+)-Estrone; 1;3;5(10)-Estratrien-3-ol-17-one; 3-Hydroxy-17-keto-estra-1;3;5-triene; 3-Hydroxyestra-1;3;5(1 |
Molecular Weight | 270.3661 |
Formula | C18H22O2 |
IUPAC | (1S;10R;11S;15S)-5-hydroxy-15-methyltetracyclo[8.7.0.0^{2;7}.0^{11;15}]heptadeca-2(7);3;5-trien-14-one |
SMILE | [H][C@@]12CCC(=O)[C@@]1(C)CC[C@]1([H])C3=C(CC[C@@]21[H])C=C(O)C=C3 |
PDB ID | NA |
KEGG | C00468 |
HMDB ID | HMDB0000145 |
Melting Point (Degree C) | 258 |
Water Solubility | NA |
Drugbank ID | DB00655 |
Receptor | NA |
Reference | HMDB
|