| Primary information |
|---|
| ID | 20695 |
| Pubchem ID | NA |
| Name | Estriol |
| Description | Estriol is a metabolite of estrone metabolized via 16alpha-hydroxyestrone through the enzyme 16alpha-hydroxysteroid dehydrogenase (EC 1.1.1.147) or to 2- or 4-hydroxyestrone (catechol estrogens) by the action of catecho-O-methyltransferase |
| Synonym | (16alpha;17beta)-Estra-1;3;5(10)-triene-3;16;17-triolChEBI1;3;5(10)-Estratriene-3;16-alpha;17beta-triolChEBI16alpha;17beta-EstriolChEBI16alpha-HydroxyestradiolChEBI3;16alpha;17beta-Trihydroxy-Delta(1; |
| Molecular Weight | 288.3814 |
| Formula | C18H24O3 |
| IUPAC | (1S;10R;11S;13R;14R;15S)-15-methyltetracyclo[8.7.0.0^{2;7}.0^{11;15}]heptadeca-2(7);3;5-triene-5;13;14-triol |
| SMILE | [H][C@@]12C[C@@H](O)[C@H](O)[C@@]1(C)CC[C@]1([H])C3=C(CC[C@@]21[H])C=C(O)C=C3 |
| PDB ID | NA |
| KEGG | C05141 |
| HMDB ID | HMDB0000153 |
| Melting Point (Degree C) | 282 |
| Water Solubility | NA |
| Drugbank ID | DB04573 |
| Receptor | NA |
| Reference | HMDB
|