| Primary information |
|---|
| ID | 20694 |
| Pubchem ID | NA |
| Name | Estradiol |
| Description | Estradiol is the most potent form of mammalian estrogenic steroids. Estradiol is produced in the ovaries. The ovary requires both luteinizing hormone (LH) and follicle-stimulating hormone (FSH) to produce sex steroids. |
| Synonym | (17beta)-Estra-1;3;5(10)-triene-3;17-diolChEBI17beta OestradiolChEBI17beta-Estra-1;3;5(10)-triene-3;17-diolChEBI17beta-OestradiolChEBIbeta-EstradiolChEBIcis-EstradiolChEBIEstradiol-17betaChEBIClimaraK |
| Molecular Weight | 272.382 |
| Formula | C18H24O2 |
| IUPAC | (1S;10R;11S;14S;15S)-15-methyltetracyclo[8.7.0.0^{2;7}.0^{11;15}]heptadeca-2(7);3;5-triene-5;14-diol |
| SMILE | [H][C@@]12CC[C@H](O)[C@@]1(C)CC[C@]1([H])C3=C(CC[C@@]21[H])C=C(O)C=C3 |
| PDB ID | NA |
| KEGG | C00951 |
| HMDB ID | HMDB0000151 |
| Melting Point (Degree C) | 178.5 |
| Water Solubility | 0.0036 mg/mL |
| Drugbank ID | DB00783 |
| Receptor | NA |
| Reference | HMDB
|