| Primary information |
|---|
| ID | 20693 |
| Pubchem ID | NA |
| Name | Dihydrotestosterone |
| Description | Dihydrotestosterone is a potent androgenic metabolite of testosterone. Dihydrotestosterone (DHT) is generated by a 5-alpha reduction of testosterone. Unlike testosterone; DHT cannot be aromatized to estradiol therefore DHT is considered a pure androgenic steroid. |
| Synonym | 17beta-Hydroxyandrostan-3-oneChEBI4;5alpha-DihydrotestosteroneChEBI5alpha-DHTChEBI5alpha-DihydrotestosteroneChEBIAndrostanolonaChEBIAndrostanoloneChEBIAndrostanolonumChEBIDHTChEBIDihydrotestosteronChE |
| Molecular Weight | 290.4403 |
| Formula | C19H30O2 |
| IUPAC | (1S;2S;7S;10R;11S;14S;15S)-14-hydroxy-2;15-dimethyltetracyclo[8.7.0.0^{2;7}.0^{11;15}]heptadecan-5-one |
| SMILE | [H][C@@]12CC[C@H](O)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CC[C@@]2([H])CC(=O)CC[C@]12C |
| PDB ID | NA |
| KEGG | C03917 |
| HMDB ID | HMDB0002961 |
| Melting Point (Degree C) | 181 |
| Water Solubility | 525 mg/mL at 25 °C |
| Drugbank ID | DB02901 |
| Receptor | NA |
| Reference | HMDB
|