| Primary information |
|---|
| ID | 20691 |
| Pubchem ID | NA |
| Name | Dehydroepiandrosterone |
| Description | Dehydroepiandrosterone (DHEA) is a natural steroid hormone produced from cholesterol by the adrenal glands. DHEA is also produced in the gonads; adipose tissue; and the brain. DHEA is structurally similar to and is a precursor of; androstenedione; testosterone; estradiol; estrone; and estrogen. |
| Synonym | 3-BETA-HYDROXY-5-androsten-17-oneChEBI3beta-Hydroxyandrost-5-en-17-oneChEBIDehydroisoandrosteroneChEBIDHAChEBIDHEAChEBIIntrarosaChEBIPrasteroneChEBIBiolaifKegg3-b-HYDROXY-5-androsten-17-oneGenerator3- |
| Molecular Weight | 288.4244 |
| Formula | C19H28O2 |
| IUPAC | (1S;2R;5S;10R;11S;15S)-5-hydroxy-2;15-dimethyltetracyclo[8.7.0.0^{2;7}.0^{11;15}]heptadec-7-en-14-one |
| SMILE | [H][C@@]12CCC(=O)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CC=C2C[C@@H](O)CC[C@]12C |
| PDB ID | NA |
| KEGG | C01227 |
| HMDB ID | HMDB0000077 |
| Melting Point (Degree C) | 140 |
| Water Solubility | 0.064 mg/mL |
| Drugbank ID | DB01708 |
| Receptor | NA |
| Reference | HMDB
|