| Primary information |
|---|
| ID | 20690 |
| Pubchem ID | NA |
| Name | Cortisone |
| Description | Cortisone is a naturally occurring glucocorticoid. It has been used in replacement therapy for adrenal insufficiency and as an anti-inflammatory agent. Cortisone itself is inactive. It is converted in the liver into the active metabolite cortisol. Cortisone is a corticosteroid hormone released by th |
| Synonym | 11-Dehydro-17-hydroxycorticosteroneChEBI17-Hydroxy-11-dehydrocorticosteroneChEBI17alpha;21-Dihydroxy-4-pregnene-3;11;20-trioneChEBI4-Pregnene-17alpha;21-diol-3;11;20-trioneChEBICortisonChEBIDelta(4)-P |
| Molecular Weight | 360.444 |
| Formula | C21H28O5 |
| IUPAC | (1S;2R;10S;11S;14R;15S)-14-hydroxy-14-(2-hydroxyacetyl)-2;15-dimethyltetracyclo[8.7.0.0^{2;7}.0^{11;15}]heptadec-6-ene-5;17-dione |
| SMILE | [H][C@@]12CC[C@](O)(C(=O)CO)[C@@]1(C)CC(=O)[C@@]1([H])[C@@]2([H])CCC2=CC(=O)CC[C@]12C |
| PDB ID | NA |
| KEGG | C00762 |
| HMDB ID | HMDB0002802 |
| Melting Point (Degree C) | 222 |
| Water Solubility | 0.28 mg/mL at 25 °C |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|