| Primary information |
|---|
| ID | 20689 |
| Pubchem ID | NA |
| Name | Cortisol |
| Description | Cortisol is the main glucocorticoid secreted by the adrenal cortex and it is involved in the stress response. Its synthetic counterpart hydrocortisone is used; either as an injection or topically; in the treatment of inflammation; allergy; collagen diseases; asthma; adrenocortical deficiency; shock; |
| Synonym | (11beta)-11;17;21-Trihydroxypregn-4-ene-3;20-dioneChEBI11beta;17alpha;21-Trihydroxy-4-pregnene-3;20-dioneChEBI11beta-HydrocortisoneChEBI17-HydroxycorticosteroneChEBI4-Pregnen-11beta;17alpha;21-triol-3 |
| Molecular Weight | 362.4599 |
| Formula | C21H30O5 |
| IUPAC | (1S;2R;10S;11S;14R;15S;17S)-14;17-dihydroxy-14-(2-hydroxyacetyl)-2;15-dimethyltetracyclo[8.7.0.0^{2;7}.0^{11;15}]heptadec-6-en-5-one |
| SMILE | [H][C@@]12CC[C@](O)(C(=O)CO)[C@@]1(C)C[C@H](O)[C@@]1([H])[C@@]2([H])CCC2=CC(=O)CC[C@]12C |
| PDB ID | NA |
| KEGG | C00735 |
| HMDB ID | HMDB0000063 |
| Melting Point (Degree C) | 220 |
| Water Solubility | 0.32 mg/mL |
| Drugbank ID | DB00741 |
| Receptor | NA |
| Reference | HMDB
|