| Primary information |
|---|
| ID | 20688 |
| Pubchem ID | NA |
| Name | Corticosterone |
| Description | Corticosterone; also known as 17-deoxycortisol; belongs to the class of organic compounds known as 21-hydroxysteroids. These are steroids carrying a hydroxyl group at the 21-position of the steroid backbone. Thus; corticosterone is considered to be a steroid lipid molecule. Corticosterone is a very |
| Synonym | (11beta)-11;21-Dihydroxypregn-4-ene-3;20-dioneChEBI11beta;21-Dihydroxy-4-pregnene-3;20-dioneChEBI11beta;21-DihydroxyprogesteroneChEBI17-DeoxycortisolChEBIKendall's compound bChEBIReichstein's substanc |
| Molecular Weight | 346.4605 |
| Formula | C21H30O4 |
| IUPAC | (1S;2R;10S;11S;14S;15S;17S)-17-hydroxy-14-(2-hydroxyacetyl)-2;15-dimethyltetracyclo[8.7.0.0^{2;7}.0^{11;15}]heptadec-6-en-5-one |
| SMILE | [H][C@@]1(CC[C@@]2([H])[C@]3([H])CCC4=CC(=O)CC[C@]4(C)[C@@]3([H])[C@@]([H])(O)C[C@]12C)C(=O)CO |
| PDB ID | NA |
| KEGG | C02140 |
| HMDB ID | HMDB0001547 |
| Melting Point (Degree C) | 179 |
| Water Solubility | 0.2 mg/mL |
| Drugbank ID | DB04652 |
| Receptor | NA |
| Reference | HMDB
|