Primary information |
---|
ID | 20687 |
Pubchem ID | NA |
Name | Cholesterol |
Description | Cholesterol is a sterol (a combination steroid and alcohol) and a lipid found in the cell membranes of all body tissues and transported in the blood plasma of all animals. |
Synonym | (3beta;14beta;17alpha)-Cholest-5-en-3-olChEBICholest-5-en-3beta-olChEBICholesterinChEBI(3b;14b;17a)-Cholest-5-en-3-olGenerator(3Β;14β;17α)-cholest-5-en-3-olGeneratorCholest-5-en-3b-olGeneratorCholest- |
Molecular Weight | 386.6535 |
Formula | C27H46O |
IUPAC | (1S;2R;5S;10S;11S;14R;15R)-2;15-dimethyl-14-[(2R)-6-methylheptan-2-yl]tetracyclo[8.7.0.0^{2;7}.0^{11;15}]heptadec-7-en-5-ol |
SMILE | [H][C@@]1(CC[C@@]2([H])[C@]3([H])CC=C4C[C@@H](O)CC[C@]4(C)[C@@]3([H])CC[C@]12C)[C@H](C)CCCC(C)C |
PDB ID | NA |
KEGG | C00187 |
HMDB ID | HMDB0000067 |
Melting Point (Degree C) | 148 |
Water Solubility | 9.5e-05 mg/mL |
Drugbank ID | DB04540 |
Receptor | NA |
Reference | HMDB
|