Primary information |
---|
ID | 20685 |
Pubchem ID | NA |
Name | Calcidiol |
Description | Calcidiol; also known as 25(OH)D3 or rayaldee; belongs to the class of organic compounds known as vitamin d and derivatives. Vitamin D and derivatives are compounds containing a secosteroid backbone; usually secoergostane or secocholestane. Thus; calcidiol is considered to be a secosteroid lipid mol |
Synonym | (3beta;5Z;7E)-9;10-Secocholesta-5;7;10(19)-triene-3;25-diolChEBI(3S;5Z;7E)-9;10-Secocholesta-5;7;10-triene-3;25-diolChEBI(5Z;7E)-(3S)-9;10-Secocholesta-5;7;10(19)-triene-3;25-diolChEBI25(OH)D3ChEBI25- |
Molecular Weight | 400.6371 |
Formula | C27H44O2 |
IUPAC | (1S;3Z)-3-{2-[(1R;3aS;4E;7aR)-1-[(2R)-6-hydroxy-6-methylheptan-2-yl]-7a-methyl-octahydro-1H-inden-4-ylidene]ethylidene}-4-methylidenecyclohexan-1-ol |
SMILE | C[C@H](CCCC(C)(C)O)[C@@]1([H])CC[C@@]2([H])C(CCC[C@]12C)=CC=C1C[C@@H](O)CCC1=C |
PDB ID | NA |
KEGG | C01561 |
HMDB ID | HMDB0003550 |
Melting Point (Degree C) | NA |
Water Solubility | NA |
Drugbank ID | DB00146 |
Receptor | NA |
Reference | HMDB
|