| Primary information |
|---|
| ID | 20684 |
| Pubchem ID | NA |
| Name | Androstenedione |
| Description | Androstenedione is a delta-4 19-carbon steroid that is produced not only in the testis; but also in the ovary and the adrenal cortex. Depending on the tissue type; androstenedione can serve as a precursor to testosterone as well as estrone and estradiol. It is the common precursor of male and female |
| Synonym | 4-Androstene-3;17-dioneChEBI4-ANDROSTENE-3-17-dioneChEBIdelta(4)-Androsten-3;17-dioneChEBIdelta(4)-Androstene-3;17-dioneChEBIΔ(4)-Androsten-3;17-dioneGeneratorΔ(4)-Androstene-3;17-dioneGenerator(4)-An |
| Molecular Weight | 286.4085 |
| Formula | C19H26O2 |
| IUPAC | (1S;2R;10R;11S;15S)-2;15-dimethyltetracyclo[8.7.0.0^{2;7}.0^{11;15}]heptadec-6-ene-5;14-dione |
| SMILE | [H][C@@]12CCC(=O)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CCC2=CC(=O)CC[C@]12C |
| PDB ID | NA |
| KEGG | C00280 |
| HMDB ID | HMDB0000053 |
| Melting Point (Degree C) | 170 |
| Water Solubility | 0.058 mg/mL |
| Drugbank ID | DB01536 |
| Receptor | NA |
| Reference | HMDB
|