| Primary information |
|---|
| ID | 20683 |
| Pubchem ID | NA |
| Name | Aldosterone |
| Description | Aldosterone is a steroid hormone produced by the adrenal cortex in the adrenal gland to regulate sodium and potassium balance in the blood. Specifically; it regulates electrolyte and water balance by increasing the renal retention of sodium and the excretion of potassium. It is synthesized from chol |
| Synonym | (+)-AldosteroneChEBI(11beta)-11;21-Dihydroxy-3;20-dioxopregn-4-en-18-alChEBI11beta;21-Dihydroxy-3;20-dioxo-4-pregnen-18-alChEBI(11b)-11;21-Dihydroxy-3;20-dioxopregn-4-en-18-alGenerator(11Β)-11;21-dihy |
| Molecular Weight | 360.444 |
| Formula | C21H28O5 |
| IUPAC | (1S;2R;10S;11S;14S;15R;17S)-17-hydroxy-14-(2-hydroxyacetyl)-2-methyl-5-oxotetracyclo[8.7.0.0^{2;7}.0^{11;15}]heptadec-6-ene-15-carbaldehyde |
| SMILE | [H][C@@]12CC[C@H](C(=O)CO)[C@]1(C[C@H](O)[C@@]1([H])[C@@]2([H])CCC2=CC(=O)CC[C@]12C)C=O |
| PDB ID | NA |
| KEGG | C01780 |
| HMDB ID | HMDB0000037 |
| Melting Point (Degree C) | 166.5 |
| Water Solubility | 0.051 mg/mL at 37 °C |
| Drugbank ID | DB04630 |
| Receptor | NA |
| Reference | HMDB
|