Detailed description page of Hmrbase2
| This page displays user query in tabular form. |
20680 details |
| Primary information | |
|---|---|
| ID | 20680 |
| Pubchem ID | 440622 |
| Name | 19-oxoandrostenedione |
| Description | 19-oxoandrostenedione belongs to androgens and derivatives class of compounds. Those are 3-hydroxylated C19 steroid hormones. They are known to favor the development of masculine characteristics. They also show profound effects on scalp and body hair in humans. 19-oxoandrostenedione is practically i |
| Synonym | NA |
| Molecular Weight | 300.398 |
| Formula | C19H24O3 |
| IUPAC | 15-methyl-5;14-dioxotetracyclo[8.7.0.0²;⁷.0¹¹;¹⁵]heptadec-6-ene-2-carbaldehyde |
| SMILE | CC12CCC3C(CCC4=CC(=O)CCC34C=O)C1CCC2=O |
| PDB ID | NA |
| KEGG | NA |
| HMDB ID | HMDB0304035 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB |