| Primary information |
|---|
| ID | 20677 |
| Pubchem ID | 200149 |
| Name | 6-beta-hydroxyprogesterone |
| Description | 6-beta-hydroxyprogesterone; also known as 6b-hydroxy-4-pregnen-3;20-dione or 3;20-dioxopregn-4-en-6beta-ol; belongs to the class of organic compounds known as gluco/mineralocorticoids; progestogins and derivatives. These are steroids with a structure based on a hydroxylated prostane moiety. 6-beta-h |
| Synonym | 3;20-Dioxopregn-4-en-6beta-ol;6beta-Hydroxy-4-pregnen-3;20-dione;6beta-Hydroxy-4-pregnene-3;20-dione;6beta-Hydroxydeoxycorticosterone;3;20-Dioxopregn-4-en-6b-ol;3;20-Dioxopregn-4-en-6β-ol;6b-Hydroxy-4 |
| Molecular Weight | 330.4611 |
| Formula | C21H30O3 |
| IUPAC | (1S;2R;8R;10S;11S;14S;15S)-14-acetyl-8-hydroxy-2;15-dimethyltetracyclo[8.7.0.0²;⁷.0¹¹;¹⁵]heptadec-6-en-5-one |
| SMILE | CC(=O)[C@H]1CC[C@H]2[C@@H]3C[C@@H](O)C4=CC(=O)CC[C@]4(C)[C@H]3CC[C@]12C |
| PDB ID | NA |
| KEGG | NA |
| HMDB ID | HMDB0061004 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|