| Primary information |
|---|
| ID | 20674 |
| Pubchem ID | 15818 |
| Name | Androstan-3alpha;17beta-diol |
| Description | Androstan-3alpha;17beta-diol; also known as hombreol or (3a;5a;17b)-androstane-3;17-diol; belongs to the class of organic compounds known as androgens and derivatives. These are 3-hydroxylated C19 steroid hormones. They are known to favor the development of masculine characteristics. They also show |
| Synonym | (3alpha;5alpha;17beta)-Androstane-3;17-diol;3alpha;17beta-Dihydroxy-5alpha-androstane;Hombreol;(3a;5a;17b)-Androstane-3;17-diol;(3Α;5α;17β)-androstane-3;17-diol;3a;17b-Dihydroxy-5a-androstane;3Α;17β-d |
| Molecular Weight | 292.4562 |
| Formula | C19H32O2 |
| IUPAC | (5R;14S)-2;15-dimethyltetracyclo[8.7.0.0²;⁷.0¹¹;¹⁵]heptadecane-5;14-diol |
| SMILE | CC12CCC3C(CCC4C[C@H](O)CCC34C)C1CC[C@@H]2O |
| PDB ID | NA |
| KEGG | NA |
| HMDB ID | HMDB0060437 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|