| Primary information |
|---|
| ID | 20672 |
| Pubchem ID | 150968 |
| Name | w Hydroxy testosterone |
| Description | w Hydroxy testosterone belongs to the class of organic compounds known as androgens and derivatives. These are 3-hydroxylated C19 steroid hormones. They are known to favor the development of masculine characteristics. They also show profound effects on scalp and body hair in humans. Thus; W hydroxy |
| Synonym | 17beta;19-Dihydroxyandrost-4-en-3-one;17b;19-Dihydroxyandrost-4-en-3-one;17Β;19-dihydroxyandrost-4-en-3-one;17 beta;19-Dihydroxyandrost-4-en-3-one;17beta;19-Dihydroxyandrost-4-en-3-one;17b;19-Dihydrox |
| Molecular Weight | 304.4238 |
| Formula | C19H28O3 |
| IUPAC | (1S;2S;10R;11S;14S;15S)-14-hydroxy-2-(hydroxymethyl)-15-methyltetracyclo[8.7.0.0²;⁷.0¹¹;¹⁵]heptadec-6-en-5-one |
| SMILE | C[C@]12CC[C@H]3[C@@H](CCC4=CC(=O)CC[C@]34CO)[C@@H]1CC[C@@H]2O |
| PDB ID | NA |
| KEGG | C05294 |
| HMDB ID | HMDB0060089 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|