| Primary information |
|---|
| ID | 20671 |
| Pubchem ID | 1486 |
| Name | 2;4-Dichlorophenoxyacetic acid |
| Description | 2;4-D is a member of the phenoxy family of herbicides; which include:; 2;4-D is a synthetic auxin; which is a class of plant hormones. It is absorbed through the leaves and is translocated to the meristems of the plant. Uncontrolled; unsustainable growth ensues; causing stem curl-over; leaf witherin |
| Synonym | (2;4-Dichlorphenoxy)essigsaeure;2;4-D acid;2;4-Dichlorophenoxyacetate;2;4-Dichlorphenoxyessigsaeure;Acide 2;4-dichloro phenoxyacetique;Hedonal;Trinoxol;2;4-D;(2; 4-Dichlorophenoxy)acetic acid;(2;4-Dic |
| Molecular Weight | 221.037 |
| Formula | C8H6Cl2O3 |
| IUPAC | 2-(2;4-dichlorophenoxy)acetic acid |
| SMILE | OC(=O)COC1=C(Cl)C=C(Cl)C=C1 |
| PDB ID | NA |
| KEGG | C03664 |
| HMDB ID | HMDB0041797 |
| Melting Point (Degree C) | 140.5 |
| Water Solubility | 0.68 mg/mL at 25 °C |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|