| Primary information |
|---|
| ID | 20669 |
| Pubchem ID | 131752688 |
| Name | Sorgolactone |
| Description | Sorgolactone is found in cereals and cereal products. Sorgolactone is isolated from the roots of Sorghum bicolor (sorghum) (genuine host plant for Striga species) Strigolactones are plant hormones that have been implicated in inhibition of shoot branching. Strigolactones are carotenoid-derived and t |
| Synonym | NA |
| Molecular Weight | 316.3484 |
| Formula | C18H20O5 |
| IUPAC | 3-methyl-5-{[(3Z)-8-methyl-2-oxo-2H;3H;3aH;4H;5H;6H;7H;8H;8bH-indeno[1;2-b]furan-3-ylidene]methoxy}-2;5-dihydrofuran-2-one |
| SMILE | CC1CCCC2=C1C1OC(=O)C(=C/OC3OC(=O)C(C)=C3)C1C2 |
| PDB ID | NA |
| KEGG | C09186 |
| HMDB ID | HMDB0039607 |
| Melting Point (Degree C) | 139 |
| Water Solubility | 56.96 mg/L at 25 °C |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|