| Primary information |
|---|
| ID | 20668 |
| Pubchem ID | 6391814 |
| Name | Strigol |
| Description | Strigol is found in corn. Strigol is a constituent of the root of Gossypium hirsutum (cotton) Strigolactones are plant hormones that have been implicated in inhibition of shoot branching. Strigolactones are carotenoid-derived and trigger germination of parasitic plant seeds (for example striga from |
| Synonym | NA |
| Molecular Weight | 346.3744 |
| Formula | C19H22O6 |
| IUPAC | 5-{[(3E)-5-hydroxy-8;8-dimethyl-2-oxo-2H;3H;3aH;4H;5H;6H;7H;8H;8bH-indeno[1;2-b]furan-3-ylidene]methoxy}-3-methyl-2;5-dihydrofuran-2-one |
| SMILE | CC1=CC(OC=C2/C3CC4=C(C3OC2=O)C(C)(C)CCC4O)OC1=O |
| PDB ID | NA |
| KEGG | C09190 |
| HMDB ID | HMDB0036677 |
| Melting Point (Degree C) | 200 |
| Water Solubility | 1030 mg/L at 25 °C |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|