| Primary information |
|---|
| ID | 20667 |
| Pubchem ID | 6852393 |
| Name | 5alpha-Androst-16-en-3-one |
| Description | 5alpha-Androst-16-en-3-one; also known as androstenone; belongs to the class of organic compounds known as androgens and derivatives. These are 3-hydroxylated C19 steroid hormones. They are known to favour the development of masculine characteristics. They also show profound effects on scalp and bod |
| Synonym | Androstenone;5a-Androst-16-en-3-one;5Α-androst-16-en-3-one;Androst-16-en-3-one;5 alpha-Androst-16-en-3-one;AEON steroid;Androst-16-en-3-one; (5beta)-isomer;(5alpha)-Androst-16-en-3-one;(5Α)-androst-16 |
| Molecular Weight | 272.432 |
| Formula | C19H28O |
| IUPAC | (1S;2S;7S;10R;11S;15R)-2;15-dimethyltetracyclo[8.7.0.0^{2;7}.0^{11;15}]heptadec-13-en-5-one |
| SMILE | [H][C@@]12CC=C[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CC[C@@]2([H])CC(=O)CC[C@]12C |
| PDB ID | NA |
| KEGG | NA |
| HMDB ID | HMDB0034406 |
| Melting Point (Degree C) | 140 |
| Water Solubility | 3.16 mg/L at 25 °C |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|