| Primary information |
|---|
| ID | 20666 |
| Pubchem ID | 5281166 |
| Name | Jasmonic acid |
| Description | Jasmonic acid; also known as jasmonate; belongs to the class of organic compounds known as jasmonic acids. These are lipids containing or derived from a jasmonic acid; with a structure characterized by the presence of an alkene chain linked to a 2-(3-oxocyclopentyl)acetic acid moiety. Based on a lit |
| Synonym | (-)-Jasmonic acid;(1R;2R)-3-oxo-2-(2Z)-2-Penten-ylcyclopentanacetic acid;(1R;2R)-3-oxo-2-(Pent-2Z-enyl)-cyclopentaneacetic acid;2-{(1R;2R)-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl}acetate;Jasmonate;{(1R;2 |
| Molecular Weight | 210.2695 |
| Formula | C12H18O3 |
| IUPAC | 2-[(1R;2R)-3-oxo-2-[(2Z)-pent-2-en-1-yl]cyclopentyl]acetic acid |
| SMILE | CCC=C/C[C@@H]1[C@@H](CC(O)=O)CCC1=O |
| PDB ID | NA |
| KEGG | C08491 |
| HMDB ID | HMDB0032797 |
| Melting Point (Degree C) | NA |
| Water Solubility | 742.1 mg/L at 25 °C |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|