| Primary information |
|---|
| ID | 20663 |
| Pubchem ID | 667466 |
| Name | Chlorprothixene |
| Description | Chlorprothixene is only found in individuals that have used or taken this drug. It is a typical antipsychotic drug of the thioxanthene (tricyclic) class. Chlorprothixene exerts strong blocking effects by blocking the 5-HT2 D1; D2; D3; histamine H1; muscarinic and alpha1 adrenergic receptors. Chlorpr |
| Synonym | Alpha-Chlorprothixene;Chlorprothixen;Chlorprothixenum;Chlorprothixine;Chlorprotixen;Chlorprotixene;Chlorprotixine;Chlothixen;Clorprotixeno;a-Chlorprothixene;Α-chlorprothixene;Chloroprothixene;cis-Chlo |
| Molecular Weight | 315.86 |
| Formula | C18H18ClNS |
| IUPAC | [3-(2-chloro-9H-thioxanthen-9-ylidene)propyl]dimethylamine |
| SMILE | [H]C(CCN(C)C)=C1C2=CC(Cl)=CC=C2SC2=C1C=CC=C2 |
| PDB ID | NA |
| KEGG | C07953 |
| HMDB ID | HMDB0015369 |
| Melting Point (Degree C) | 97.5 |
| Water Solubility | 0.00037 g/L |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|