| Primary information |
|---|
| ID | 20661 |
| Pubchem ID | 17676 |
| Name | Acetophenazine |
| Description | Acetophenazine is only found in individuals that have used or taken this drug.It is an antipsychotic drug of moderate-potency. It is used in the treatment of disorganized and psychotic thinking. It is also used to help treat false perceptions (e.g. hallucinations or delusions).Acetophenazine blocks |
| Synonym | Tindal;Acetophenazine; (Z)-2-maleate (1:2) salt;Acetophenazine; ion (1+);Acetophenazine maleate;Tindal;Acetophenazine; (Z)-2-maleate (1:2) salt;Acetophenazine; ion (1+);Acetophenazine maleate;Acetophe |
| Molecular Weight | 411.56 |
| Formula | C23H29N3O2S |
| IUPAC | 1-(10-{3-[4-(2-hydroxyethyl)piperazin-1-yl]propyl}-10H-phenothiazin-2-yl)ethan-1-one |
| SMILE | CC(=O)C1=CC=C2SC3=C(C=CC=C3)N(CCCN3CCN(CCO)CC3)C2=C1 |
| PDB ID | NA |
| KEGG | C06807 |
| HMDB ID | HMDB0015196 |
| Melting Point (Degree C) | NA |
| Water Solubility | 0.06 g/L |
| Drugbank ID | NA |
| Receptor | P10275 |
| Reference | HMDB
|