| Primary information |
|---|
| ID | 20660 |
| Pubchem ID | 25137957 |
| Name | Carphenazine |
| Description | Carphenazine is only found in individuals that have used or taken this drug. It is an antipsychotic drug; used in hospitalized patients in the management of chronic schizophrenic psychoses.A yellow; powdered; phenothiazine antipsychotic agent used in the treatment of acute or chronic schizophrenia. |
| Synonym | 1-(10-(3-(4-(2-Hydroxyethyl)-1-piperazinyl)propyl)phenothiazin-2-yl)-1-propanone;Carfenazina;Carfenazine;Carfenazinum;Carphenazin;1-(10-(3-(4-(2-Hydroxyethyl)-1-piperazinyl)propyl)phenothiazin-2-yl)-1 |
| Molecular Weight | 411.56 |
| Formula | C23H29N3O2S |
| IUPAC | 1-(10-{2-[4-(2-hydroxyethyl)piperazin-1-yl]ethyl}-10H-phenothiazin-2-yl)propan-1-one |
| SMILE | CCC(=O)C1=CC2=C(SC3=C(C=CC=C3)N2CCN2CCN(CCO)CC2)C=C1 |
| PDB ID | NA |
| KEGG | NA |
| HMDB ID | HMDB0015172 |
| Melting Point (Degree C) | NA |
| Water Solubility | 0.09 g/L |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|