| Primary information |
|---|
| ID | 20659 |
| Pubchem ID | 6011 |
| Name | Drostanolone |
| Description | Drostanolone is only found in individuals that have used or taken this drug. It is a potent synthetic androgenic anabolic steroid similar to testosterone. Drostanolone is indicated in postmenopausal women with recurrent breast cancer; in a combined hormone therapy.Dromostanolone is a synthetic andro |
| Synonym | 17beta-Hydroxy-2alpha-methyl-5alpha-androstan-3-one;2alpha-Methyldihydrotestosterone;Dihydro-2alpha-methyltestosterone;Dromostanolone;Drostanolona;Drostanolonum;Medrosteron;Medrotestron;17b-Hydroxy-2a |
| Molecular Weight | 304.4669 |
| Formula | C20H32O2 |
| IUPAC | (1S;2S;4R;7S;10R;11S;14S;15S)-14-hydroxy-2;4;15-trimethyltetracyclo[8.7.0.0²;⁷.0¹¹;¹⁵]heptadecan-5-one |
| SMILE | [H][C@@]12CC[C@H](O)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CC[C@@]2([H])CC(=O)[C@H](C)C[C@]12C |
| PDB ID | NA |
| KEGG | C14605 |
| HMDB ID | HMDB0014996 |
| Melting Point (Degree C) | 128 |
| Water Solubility | 0.006 g/L |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|