| Primary information |
|---|
| ID | 20658 |
| Pubchem ID | 5566 |
| Name | Trifluoperazine |
| Description | Trifluoperazine is only found in individuals that have used or taken this drug. It is a phenothiazine with actions similar to chlorpromazine. It is used as an antipsychotic and an antiemetic. [PubChem]Trifluoperazine blocks postsynaptic mesolimbic dopaminergic D1 and D2 receptors in the brain; depre |
| Synonym | 10-[3-(4-Methyl-1-piperazinyl)propyl]-2-(trifluoromethyl)-10H-phenothiazine;10-[3-(4-METHYL-piperazin-1-yl)-propyl]-2-trifluoromethyl-10H-phenothiazine;Trifluoperazina;Trifluoperazinum;Trifluoromethyl |
| Molecular Weight | 407.496 |
| Formula | C21H24F3N3S |
| IUPAC | 10-[3-(4-methylpiperazin-1-yl)propyl]-2-(trifluoromethyl)-10H-phenothiazine |
| SMILE | CN1CCN(CCCN2C3=CC=CC=C3SC3=C2C=C(C=C3)C(F)(F)F)CC1 |
| PDB ID | NA |
| KEGG | C07168 |
| HMDB ID | HMDB0014969 |
| Melting Point (Degree C) | NA |
| Water Solubility | 0.0088 g/L |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|