| Primary information |
|---|
| ID | 20653 |
| Pubchem ID | NA |
| Name | Mitotane |
| Description | Mitotane is only found in individuals that have used or taken this drug. It is a derivative of the insecticide dichlorodiphenyldichloroethane that specifically inhibits cells of the adrenal cortex and their production of hormones. It is used to treat adrenocortical tumors and causes CNS damage; but |
| Synonym | Lysodren;Bristol myers squibb brand OF mitotane;Khloditan;ortho;Para-DDD;Chloditan;Bristol-myers squibb brand OF mitotane;O;P-DDD;ortho;Para DDD;Chlodithane;Mytotan;Lysodren;Bristol myers squibb brand |
| Molecular Weight | 320.041 |
| Formula | C14H10Cl4 |
| IUPAC | 1-chloro-4-[2;2-dichloro-1-(2-chlorophenyl)ethyl]benzene |
| SMILE | ClC(Cl)C(C1=CC=C(Cl)C=C1)C1=CC=CC=C1Cl |
| PDB ID | NA |
| KEGG | NA |
| HMDB ID | HMDB0014786 |
| Melting Point (Degree C) | 77 |
| Water Solubility | 9.4e-06 g/L |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|