| Primary information |
|---|
| ID | 20652 |
| Pubchem ID | 3372 |
| Name | Fluphenazine |
| Description | Fluphenazine is only found in individuals that have used or taken this drug. It is a phenothiazine used in the treatment of psychoses. Its properties and uses are generally similar to those of chlorpromazine. [PubChem]Fluphenazine blocks postsynaptic mesolimbic dopaminergic D1 and D2 receptors in th |
| Synonym | 1-(2-Hydroxyethyl)-4-(3-(trifluoromethyl-10-phenothiazinyl)propyl)-piperazine;10-(3'-(4''-(beta-Hydroxyethyl)-1''-piperazinyl)-propyl)-3-trifluoromethylphenothiazine;10-(3-(2-Hydroxyethyl)piperazinopr |
| Molecular Weight | 437.522 |
| Formula | C22H26F3N3OS |
| IUPAC | 2-(4-{3-[2-(trifluoromethyl)-10H-phenothiazin-10-yl]propyl}piperazin-1-yl)ethan-1-ol |
| SMILE | OCCN1CCN(CCCN2C3=CC=CC=C3SC3=C2C=C(C=C3)C(F)(F)F)CC1 |
| PDB ID | NA |
| KEGG | C07010 |
| HMDB ID | HMDB0014761 |
| Melting Point (Degree C) | 25 |
| Water Solubility | 0.019 g/L |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|