| Primary information |
|---|
| ID | 20649 |
| Pubchem ID | 3247060 |
| Name | 4b-Hydroxycholesterol |
| Description | 4b-Hydroxycholesterol; also known as cholest-5-en-3b;4b-diol; belongs to the class of organic compounds known as cholesterols and derivatives. Cholesterols and derivatives are compounds containing a 3-hydroxylated cholestane core. Thus; 4b-hydroxycholesterol is considered to be a sterol lipid molecu |
| Synonym | (3beta;4beta)-Cholest-5-ene-3;4-diol;Cholest-5-en-3beta;4beta-diol;(3b;4b)-Cholest-5-ene-3;4-diol;(3Β;4β)-cholest-5-ene-3;4-diol;Cholest-5-en-3b;4b-diol;Cholest-5-en-3β;4β-diol;(4b)-Cholest-5-ene-3b;4 |
| Molecular Weight | 402.6529 |
| Formula | C27H46O2 |
| IUPAC | (1S;2R;5S;6R;10S;11S;14R;15R)-2;15-dimethyl-14-[(2R)-6-methylheptan-2-yl]tetracyclo[8.7.0.0²;⁷.0¹¹;¹⁵]heptadec-7-ene-5;6-diol |
| SMILE | [H][C@@]1(CC[C@@]2([H])[C@]3([H])CC=C4[C@@H](O)[C@@H](O)CC[C@]4(C)[C@@]3([H])CC[C@]12C)[C@H](C)CCCC(C)C |
| PDB ID | NA |
| KEGG | NA |
| HMDB ID | HMDB0013643 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|