| Primary information |
|---|
| ID | 20648 |
| Pubchem ID | 245259 |
| Name | Beta-Cortolone |
| Description | Beta-Cortolone; also known as b-cortolone; belongs to the class of organic compounds known as 21-hydroxysteroids. These are steroids carrying a hydroxyl group at the 21-position of the steroid backbone. Thus; Beta-cortolone is considered to be a steroid. Based on a literature review a significant nu |
| Synonym | b-Cortolone;Β-cortolone;b-Cortolon;beta-Cortolon;b-Cortolone;Β-cortolone;b-Cortolon;beta-Cortolon;Β-cortolone;b-Cortolon;beta-Cortolon |
| Molecular Weight | 366.4917 |
| Formula | C21H34O5 |
| IUPAC | (2S;5S;14S;15S)-14-(1;2-dihydroxyethyl)-5;14-dihydroxy-2;15-dimethyltetracyclo[8.7.0.0²;⁷.0¹¹;¹⁵]heptadecan-17-one |
| SMILE | C[C@]12CC(=O)C3C(CCC4C[C@@H](O)CC[C@]34C)C1CC[C@@]2(O)C(O)CO |
| PDB ID | NA |
| KEGG | NA |
| HMDB ID | HMDB0013221 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|