| Primary information |
|---|
| ID | 20647 |
| Pubchem ID | 92288779 |
| Name | 5-Androstene-3alpha-16beta;17beta-triol |
| Description | 5-Androstene-3alpha-16beta;17beta-triol; also known as 5-androstene-3α-16β;17β-triol; belongs to the class of organic compounds known as androgens and derivatives. These are 3-hydroxylated C19 steroid hormones. They are known to favor the development of masculine characteristics. They also show prof |
| Synonym | 5-Androstene-3a-16b;17b-triol;5-Androstene-3α-16β;17β-triol;5-Androstene-3alpha-16beta;17beta-triol;5-Androstene-3a-16b;17b-triol;5-Androstene-3α-16β;17β-triol;5-Androstene-3alpha-16beta;17beta-triol; |
| Molecular Weight | 306.446 |
| Formula | C19H30O3 |
| IUPAC | (1S;2R;5R;10R;11S;13S;14R;15S)-2;15-dimethyltetracyclo[8.7.0.0^{2;7}.0^{11;15}]heptadec-7-ene-5;13;14-triol |
| SMILE | [H][C@@]12C[C@H](O)[C@H](O)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CC=C2C[C@H](O)CC[C@]12C |
| PDB ID | NA |
| KEGG | NA |
| HMDB ID | HMDB0013199 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|