| Primary information |
|---|
| ID | 20645 |
| Pubchem ID | 53481605 |
| Name | Somatostatin |
| Description | Somatostatin belongs to the class of organic compounds known as polypeptides. These are peptides containing ten or more amino acid residues. In humans; somatostatin is involved in the pancreas function - delta cell pathway. Somatostatin is a primary metabolite. Primary metabolites are metabolically |
| Synonym | Growth hormone-inhibiting hormone (ghih);Somatotropin release-inhibiting factor (srif);Somatotropin release-inhibiting hormone;(5S;8R;14R;17R;20R;23R;26R;29R;32R;35R)-38-[(2-{[(2R)-2-amino-1-hydroxypr |
| Molecular Weight | 1651.905 |
| Formula | C77H106N18O19S2 |
| IUPAC | (5S;8R;14R;17R;20R;23R;26R;29R;32R;35R)-20;35-bis(4-aminobutyl)-38-{2-[(2R)-2-aminopropanamido]acetamido}-14;26;29-tribenzyl-32-(carbamoylmethyl)-11-(1-hydroxyethyl)-17-[(1S)-1-hydroxyethyl]-8-(hydroxymethyl)-23-[(1H-indol-3-yl)methyl]-7;10;13;16;19;22;25;28;31;34;37-undecaoxo-1;2-dithia-6;9;12;15;18;21;24;27;30;33;36-undecaazacyclononatriacontane-5-carboxylic acid |
| SMILE | C[C@H](O)[C@H]1NC(=O)[C@@H](CCCCN)NC(=O)[C@@H](CC2=CNC3=C2C=CC=C3)NC(=O)[C@@H](CC2=CC=CC=C2)NC(=O)[C@@H](CC2=CC=CC=C2)NC(=O)[C@@H](CC(N)=O)NC(=O)[C@@H](CCCCN)NC(=O)C(CSSCC[C@H](NC(=O)[C@@H](CO)NC(=O)C(NC(=O)[C@@H](CC2=CC=CC=C2)NC1=O)C(C)O)C(O)=O)NC(=O)CNC(=O)[C@@H](C)N |
| PDB ID | NA |
| KEGG | NA |
| HMDB ID | HMDB0013072 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | P31391; P35346; P30872; P32745; P30874; P30937; P30938; O08858; P30936; P30875; P30935; P28646; P30680 |
| Reference | HMDB
|