| Primary information |
|---|
| ID | 20642 |
| Pubchem ID | 12337017 |
| Name | 4-Hydroxyestrone sulfate |
| Description | 4-Hydroxyestrone sulfate is a sulfate derivative of Estrone. Estrone (also oestrone) is an estrogenic hormone secreted by the ovary. Its molecular formula is C18H22O2. estrone has a melting point of 254.5 degrees Celsius. estrone is one of the three estrogens; which also include estriol and estradio |
| Synonym | 4-Hydroxyestrone sulfuric acid;4-Hydroxyestrone sulphate;4-Hydroxyestrone sulphuric acid;1;3;5(10)-Triene-3;4-diol-17-one 3-sulfate;1;3;5(10)-Triene-3;4-diol-17-one 3-sulphate;3;4-Dihydroxyestra-1;3;5 |
| Molecular Weight | 366.429 |
| Formula | C18H22O6S |
| IUPAC | [(15R)-6-hydroxy-15-methyl-14-oxotetracyclo[8.7.0.0²;⁷.0¹¹;¹⁵]heptadeca-2(7);3;5-trien-5-yl]oxidanesulfonic acid |
| SMILE | C[C@@]12CCC3C(CCC4=C3C=CC(OS(O)(=O)=O)=C4O)C1CCC2=O |
| PDB ID | NA |
| KEGG | NA |
| HMDB ID | HMDB0012779 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|