| Primary information |
|---|
| ID | 20639 |
| Pubchem ID | 22569148 |
| Name | 2-Hydroxyestrone sulfate |
| Description | 2-Hydroxyestrone sulfate is a sulfate derivative of Estrone. Estrone (also oestrone) is an estrogenic hormone secreted by the ovary. Its molecular formula is C18H22O2. estrone has a melting point of 254.5 degrees Celsius. estrone is one of the three estrogens; which also include estriol and estradio |
| Synonym | 2-Hydroxyestrone sulfuric acid;2-Hydroxyestrone sulphate;2-Hydroxyestrone sulphuric acid;1;3;5(10)-Triene-2;3-diol-17-one 3-sulfate;1;3;5(10)-Triene-2;3-diol-17-one 3-sulphate;2;3-Dihydroxyestra-1;3;5 |
| Molecular Weight | 366.43 |
| Formula | C18H22O6S |
| IUPAC | {4-hydroxy-15-methyl-14-oxotetracyclo[8.7.0.0^{2;7}.0^{11;15}]heptadeca-2(7);3;5-trien-5-yl}oxidanesulfonic acid |
| SMILE | CC12CCC3C(CCC4=C3C=C(O)C(OS(O)(=O)=O)=C4)C1CCC2=O |
| PDB ID | NA |
| KEGG | NA |
| HMDB ID | HMDB0012622 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|