| Primary information |
|---|
| ID | 20634 |
| Pubchem ID | 68759 |
| Name | 5beta-Cholestanone |
| Description | 5beta-Cholestanone; also known as coprostan-3-one; belongs to the class of organic compounds known as cholesterols and derivatives. Cholesterols and derivatives are compounds containing a 3-hydroxylated cholestane core. Thus; 5beta-cholestanone is considered to be a sterol. Based on a literature rev |
| Synonym | Coprostan-3-one;5b-Cholestanone;5Β-cholestanone;5beta-Cholestan-3-one;Coprostan-3-one;5b-Cholestanone;5Β-cholestanone;5beta-Cholestan-3-one;5b-Cholestanone;5Β-cholestanone;5beta-Cholestan-3-one |
| Molecular Weight | 386.6535 |
| Formula | C27H46O |
| IUPAC | (1S;2S;7R;10R;11S;14R;15R)-2;15-dimethyl-14-[(2R)-6-methylheptan-2-yl]tetracyclo[8.7.0.0²;⁷.0¹¹;¹⁵]heptadecan-5-one |
| SMILE | [H][C@@]1(CC[C@@]2([H])[C@]3([H])CC[C@]4([H])CC(=O)CC[C@]4(C)[C@@]3([H])CC[C@]12C)[C@H](C)CCCC(C)C |
| PDB ID | NA |
| KEGG | C03091 |
| HMDB ID | HMDB0011182 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|