Primary information |
---|
ID | 20634 |
Pubchem ID | 68759 |
Name | 5beta-Cholestanone |
Description | 5beta-Cholestanone; also known as coprostan-3-one; belongs to the class of organic compounds known as cholesterols and derivatives. Cholesterols and derivatives are compounds containing a 3-hydroxylated cholestane core. Thus; 5beta-cholestanone is considered to be a sterol. Based on a literature rev |
Synonym | Coprostan-3-one;5b-Cholestanone;5Β-cholestanone;5beta-Cholestan-3-one;Coprostan-3-one;5b-Cholestanone;5Β-cholestanone;5beta-Cholestan-3-one;5b-Cholestanone;5Β-cholestanone;5beta-Cholestan-3-one |
Molecular Weight | 386.6535 |
Formula | C27H46O |
IUPAC | (1S;2S;7R;10R;11S;14R;15R)-2;15-dimethyl-14-[(2R)-6-methylheptan-2-yl]tetracyclo[8.7.0.0²;⁷.0¹¹;¹⁵]heptadecan-5-one |
SMILE | [H][C@@]1(CC[C@@]2([H])[C@]3([H])CC[C@]4([H])CC(=O)CC[C@]4(C)[C@@]3([H])CC[C@]12C)[C@H](C)CCCC(C)C |
PDB ID | NA |
KEGG | C03091 |
HMDB ID | HMDB0011182 |
Melting Point (Degree C) | NA |
Water Solubility | NA |
Drugbank ID | NA |
Receptor | NA |
Reference | HMDB
|