Primary information |
---|
ID | 20633 |
Pubchem ID | 5281327 |
Name | Brassicasterol |
Description | Brassicasterol belongs to the class of organic compounds known as ergosterols and derivatives. These are steroids containing ergosta-5;7;22-trien-3beta-ol or a derivative thereof; which is based on the 3beta-hydroxylated ergostane skeleton. Thus; brassicasterol is considered to be a sterol lipid mol |
Synonym | (22E;24R)-24-Methylcholesta-5;22-dien-3beta-ol;(3beta;22E)-Ergosta-5;22-dien-3-ol;24(R)-Methylcholesta-5;22E-dien-3beta-ol;24-Methyl cholest-5;22-dien-3beta-ol;Brassicasterin;Ergosta-5;22(e)-dien-3bet |
Molecular Weight | 398.675 |
Formula | C28H46O |
IUPAC | (1S;2R;5S;10S;11S;14R;15R)-14-[(2R;3E;5R)-5;6-dimethylhept-3-en-2-yl]-2;15-dimethyltetracyclo[8.7.0.0^{2;7}.0^{11;15}]heptadec-7-en-5-ol |
SMILE | [H][C@@]1(CC[C@@]2([H])[C@]3([H])CC=C4C[C@@H](O)CC[C@]4(C)[C@@]3([H])CC[C@]12C)[C@H](C)C=C[C@H](C)C(C)C |
PDB ID | NA |
KEGG | C08813 |
HMDB ID | HMDB0011181 |
Melting Point (Degree C) | 150 |
Water Solubility | 0.00023 mg/L at 25 °C |
Drugbank ID | NA |
Receptor | NA |
Reference | HMDB
|