| Primary information |
|---|
| ID | 20632 |
| Pubchem ID | 5459827 |
| Name | 5alpha-Cholesta-7;24-dien-3beta-ol |
| Description | 5alpha-Cholesta-7;24-dien-3beta-ol belongs to the class of organic compounds known as cholesterols and derivatives. Cholesterols and derivatives are compounds containing a 3-hydroxylated cholestane core. |
| Synonym | (3beta;5alpha)-Cholesta-7;24-dien-3-ol;Cholesta-7;24-dien-3-ol;(3b;5a)-Cholesta-7;24-dien-3-ol;(3β;5α)-Cholesta-7;24-dien-3-ol;5a-Cholesta-7;24-dien-3b-ol;5α-Cholesta-7;24-dien-3β-ol;5 alpha-Cholesta- |
| Molecular Weight | 384.648 |
| Formula | C27H44O |
| IUPAC | (1R;2S;5S;7S;11R;14R;15R)-2;15-dimethyl-14-[(2R)-6-methylhept-5-en-2-yl]tetracyclo[8.7.0.0^{2;7}.0^{11;15}]heptadec-9-en-5-ol |
| SMILE | [H][C@@]1(CC[C@@]2([H])C3=CC[C@@]4([H])C[C@@H](O)CC[C@]4(C)[C@@]3([H])CC[C@]12C)[C@H](C)CCC=C(C)C |
| PDB ID | NA |
| KEGG | C05439 |
| HMDB ID | HMDB0006842 |
| Melting Point (Degree C) | 147 |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|