| Primary information |
|---|
| ID | 20631 |
| Pubchem ID | 101770 |
| Name | 5alpha-Cholest-8-en-3beta-ol |
| Description | 5alpha-Cholest-8-en-3beta-ol; also known as zymostenol; is a normal human metabolite and an intermediate of cholesterol synthesis. The concentrations of zymostenol are higher; both in the serum and bile of patients with cerebrotendinous xanthomatosis; compared to controls or in patients with cerebro |
| Synonym | Cholestenol;Zymostenol;5a-cholest-8-en-3b-ol;5α-cholest-8-en-3β-ol;(3beta;5alpha)Cholestenol;3beta-Hydroxy-8(9)-cholestene;3beta-Hydroxycholest-8(9)-ene;5-alpha-Cholest-8-en-3-beta-ol;5alpha-Cholest |
| Molecular Weight | 386.6535 |
| Formula | C27H46O |
| IUPAC | (2S;5S;7S;11R;14R;15R)-2;15-dimethyl-14-[(2R)-6-methylheptan-2-yl]tetracyclo[8.7.0.0^{2;7}.0^{11;15}]heptadec-1(10)-en-5-ol |
| SMILE | [H][C@@]1(CC[C@@]2([H])C3=C(CC[C@]12C)[C@@]1(C)CC[C@H](O)C[C@]1([H])CC3)[C@H](C)CCCC(C)C |
| PDB ID | NA |
| KEGG | C03845 |
| HMDB ID | HMDB0006841 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|