| Primary information |
|---|
| ID | 20625 |
| Pubchem ID | 53477890 |
| Name | CE(22:6(4Z;7Z;10Z;13Z;16Z;19Z)) |
| Description | Cholesteryl docosahexaenoic acid is a cholesteryl ester. A cholesteryl ester is an ester of cholesterol. Fatty acid esters of cholesterol constitute about two-thirds of the cholesterol in the plasma. Cholesterol is a sterol (a combination steroid and alcohol) and a lipid found in the cell membranes |
| Synonym | 22:6 Cholesterol ester;Cholest-5-en-3beta-yl (4Z;7Z;10Z;13Z;16Z;19Z-docosahexaenoate;Cholest-5-en-3beta-yl (4Z;7Z;10Z;13Z;16Z;19Z-docosahexaenoate);Cholest-5-en-3beta-yl (4Z;7Z;10Z;13Z;16Z;19Z-docosah |
| Molecular Weight | 697.1265 |
| Formula | C49H76O2 |
| IUPAC | (2R;5S;15R)-2;15-dimethyl-14-[(2R)-6-methylheptan-2-yl]tetracyclo[8.7.0.0²;⁷.0¹¹;¹⁵]heptadec-7-en-5-yl (4Z;7Z;10Z;13Z;16Z;19Z)-docosa-4;7;10;13;16;19-hexaenoate |
| SMILE | CCC=C/CC=C/CC=C/CC=C/CC=C/CC=C/CCC(=O)O[C@H]1CC[C@]2(C)C3CC[C@]4(C)C(CCC4C3CC=C2C1)[C@H](C)CCCC(C)C |
| PDB ID | NA |
| KEGG | C02530 |
| HMDB ID | HMDB0006733 |
| Melting Point (Degree C) | NA |
| Water Solubility | NA |
| Drugbank ID | NA |
| Receptor | NA |
| Reference | HMDB
|