| Primary information |
|---|
| ID | 20619 |
| Pubchem ID | NA |
| Name | Alfacalcidol |
| Description | Alfacalcidol is an active metabolite of Vitamin D; which performs important functions in regulation of the calcium balance and the bone metabolism. Alfacalcidol is Vitamin D-hormone analog which is activated by the enzyme 25-hydroxylase in the liver for systemic and in osteoblasts for local D-hormon |
| Synonym | (5Z;7E)-9;10-Seco-5;7;10(19)-cholestatrien-1alpha;3beta-diolChEBI1alpha-Hydroxy-vitamin D3ChEBI1alpha-HydroxycholecalciferolChEBI1alpha-Hydroxyvitamin D3ChEBI9;10-Secocholesta-5;7;10(19)-triene-1alpha |
| Molecular Weight | 400.6371 |
| Formula | NA |
| IUPAC | (1R;3S;5Z)-5-{2-[(1R;3aS;4E;7aR)-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-octahydro-1H-inden-4-ylidene]ethylidene}-4-methylidenecyclohexane-1;3-diol |
| SMILE | CC(C)CCC[C@@H](C)[C@@]1([H])CC[C@@]2([H])C(CCC[C@]12C)=CC=C1C[C@@H](O)C[C@H](O)C1=C |
| PDB ID | NA |
| KEGG | NA |
| HMDB ID | HMDB0015504 |
| Melting Point (Degree C) | 136 |
| Water Solubility | 0.0016 g/L |
| Drugbank ID | DB01436 |
| Receptor | NA |
| Reference | HMDB
|